C10H17F2NO — CID 103207509
1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine (PubChem CID 103207509) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine.
| Compound Name | 1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103207509 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-(cyclopenten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)F)C1=CCCC1 |
| InChI | InChI=1S/C10H17F2NO/c11-10(12)7-14-6-5-9(13)8-3-1-2-4-8/h3,9-10H,1-2,4-7,13H2 |
| InChIKey | OVHVZBGRHZLYGD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|