C12H21F2NO — CID 103207519
1-(cyclohepten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine (PubChem CID 103207519) has the molecular formula C12H21F2NO and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103207519 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-(cyclohepten-1-yl)-3-(2,2-difluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)F)C1=CCCCCC1 |
| InChI | InChI=1S/C12H21F2NO/c13-12(14)9-16-8-7-11(15)10-5-3-1-2-4-6-10/h5,11-12H,1-4,6-9,15H2 |
| InChIKey | ZUEOCTWQFQRMCH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|