C12H16BrClF3NOS — CID 103208018
1-(4-bromo-5-chlorothiophen-2-yl)-N-propyl-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103208018) has the molecular formula C12H16BrClF3NOS and a molecular weight of 394.68 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-propyl-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-propyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103208018 |
| Molecular Formula | C12H16BrClF3NOS |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-propyl-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CCCNC(CCOCC(F)(F)F)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C12H16BrClF3NOS/c1-2-4-18-9(3-5-19-7-12(15,16)17)10-6-8(13)11(14)20-10/h6,9,18H,2-5,7H2,1H3 |
| InChIKey | PSENAAHANGHCCD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|