C9H8Br2ClF3OS — CID 103211471
3-bromo-5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-2-chlorothiophene (PubChem CID 103211471) has the molecular formula C9H8Br2ClF3OS and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-bromo-5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-2-chlorothiophene.
| Compound Name | 3-bromo-5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-2-chlorothiophene |
|---|---|
| PubChem CID | 103211471 |
| Molecular Formula | C9H8Br2ClF3OS |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 413.83 |
| IUPAC Name | 3-bromo-5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-2-chlorothiophene |
| SMILES | FC(F)(F)COCCC(Br)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C9H8Br2ClF3OS/c10-5(1-2-16-4-9(13,14)15)7-3-6(11)8(12)17-7/h3,5H,1-2,4H2 |
| InChIKey | QFJVUEJUYMCSAV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|