C12H20F2N2O2S — CID 103208329
N-(1-carbamothioylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208329) has the molecular formula C12H20F2N2O2S and a molecular weight of 294.37 g/mol. Its IUPAC name is N-(1-carbamothioylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(1-carbamothioylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208329 |
| Molecular Formula | C12H20F2N2O2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(1-carbamothioylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | NC(=S)C1(NC(=O)CCOCC(F)F)CCCCC1 |
| InChI | InChI=1S/C12H20F2N2O2S/c13-9(14)8-18-7-4-10(17)16-12(11(15)19)5-2-1-3-6-12/h9H,1-8H2,(H2,15,19)(H,16,17) |
| InChIKey | BAHGTRWDTALIQJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|