C14H24F2N2O2S — CID 103208335
N-(1-carbamothioyl-4-ethylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103208335) has the molecular formula C14H24F2N2O2S and a molecular weight of 322.42 g/mol. Its IUPAC name is N-(1-carbamothioyl-4-ethylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(1-carbamothioyl-4-ethylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208335 |
| Molecular Formula | C14H24F2N2O2S |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-(1-carbamothioyl-4-ethylcyclohexyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | CCC1CCC(NC(=O)CCOCC(F)F)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H24F2N2O2S/c1-2-10-3-6-14(7-4-10,13(17)21)18-12(19)5-8-20-9-11(15)16/h10-11H,2-9H2,1H3,(H2,17,21)(H,18,19) |
| InChIKey | DLCRTTNNRYUZTF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|