C11H9BrF4N2O — CID 103208877
5-bromo-6-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-benzimidazole (PubChem CID 103208877) has the molecular formula C11H9BrF4N2O and a molecular weight of 341.10 g/mol. Its IUPAC name is 5-bromo-6-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-benzimidazole.
| Compound Name | 5-bromo-6-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 103208877 |
| Molecular Formula | C11H9BrF4N2O |
| Molecular Weight | 341.10 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 5-bromo-6-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-benzimidazole |
| SMILES | Fc1cc2[nH]c(CCOCC(F)(F)F)nc2cc1Br |
| InChI | InChI=1S/C11H9BrF4N2O/c12-6-3-8-9(4-7(6)13)18-10(17-8)1-2-19-5-11(14,15)16/h3-4H,1-2,5H2,(H,17,18) |
| InChIKey | QLTYIIKYNVAHLM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|