C9H3BrF6N2 — CID 79631784
5-bromo-6-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 79631784) has the molecular formula C9H3BrF6N2 and a molecular weight of 333.03 g/mol. Its IUPAC name is 5-bromo-6-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 5-bromo-6-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 79631784 |
| Molecular Formula | C9H3BrF6N2 |
| Molecular Weight | 333.03 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 5-bromo-6-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | Fc1cc2[nH]c(C(F)(F)C(F)(F)F)nc2cc1Br |
| InChI | InChI=1S/C9H3BrF6N2/c10-3-1-5-6(2-4(3)11)18-7(17-5)8(12,13)9(14,15)16/h1-2H,(H,17,18) |
| InChIKey | MAQCQESMONVXLE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|