C16H10F6N2 — CID 163973604
5-(4-fluorophenyl)-6-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 163973604) has the molecular formula C16H10F6N2 and a molecular weight of 344.26 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 5-(4-fluorophenyl)-6-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 163973604 |
| Molecular Formula | C16H10F6N2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-(4-fluorophenyl)-6-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | Cc1cc2[nH]c(C(F)(F)C(F)(F)F)nc2cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H10F6N2/c1-8-6-12-13(7-11(8)9-2-4-10(17)5-3-9)24-14(23-12)15(18,19)16(20,21)22/h2-7H,1H3,(H,23,24) |
| InChIKey | SSDWGADKBPBTOX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|