C16H10ClF5N2 — CID 123142379
6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 123142379) has the molecular formula C16H10ClF5N2 and a molecular weight of 360.71 g/mol. Its IUPAC name is 6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 123142379 |
| Molecular Formula | C16H10ClF5N2 |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | Cc1ccc(-c2cc3nc(C(F)(F)C(F)(F)F)[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C16H10ClF5N2/c1-8-2-4-9(5-3-8)10-6-12-13(7-11(10)17)24-14(23-12)15(18,19)16(20,21)22/h2-7H,1H3,(H,23,24) |
| InChIKey | YWLVCEDCMHJSPH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|