C17H11ClF5N — CID 158149969
6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-3H-indole (PubChem CID 158149969) has the molecular formula C17H11ClF5N and a molecular weight of 359.73 g/mol. Its IUPAC name is 6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-3H-indole.
| Compound Name | 6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-3H-indole |
|---|---|
| PubChem CID | 158149969 |
| Molecular Formula | C17H11ClF5N |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 6-chloro-5-(4-methylphenyl)-2-(1,1,2,2,2-pentafluoroethyl)-3H-indole |
| SMILES | Cc1ccc(-c2cc3c(cc2Cl)N=C(C(F)(F)C(F)(F)F)C3)cc1 |
| InChI | InChI=1S/C17H11ClF5N/c1-9-2-4-10(5-3-9)12-6-11-7-15(16(19,20)17(21,22)23)24-14(11)8-13(12)18/h2-6,8H,7H2,1H3 |
| InChIKey | UFAMAVHHJUYZIZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|