C15H8Cl2F3NO — CID 159546280
5,6-dichloro-2-[4-(trifluoromethoxy)phenyl]-3H-indole (PubChem CID 159546280) has the molecular formula C15H8Cl2F3NO and a molecular weight of 346.14 g/mol. Its IUPAC name is 5,6-dichloro-2-[4-(trifluoromethoxy)phenyl]-3H-indole.
| Compound Name | 5,6-dichloro-2-[4-(trifluoromethoxy)phenyl]-3H-indole |
|---|---|
| PubChem CID | 159546280 |
| Molecular Formula | C15H8Cl2F3NO |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 5,6-dichloro-2-[4-(trifluoromethoxy)phenyl]-3H-indole |
| SMILES | FC(F)(F)Oc1ccc(C2=Nc3cc(Cl)c(Cl)cc3C2)cc1 |
| InChI | InChI=1S/C15H8Cl2F3NO/c16-11-5-9-6-13(21-14(9)7-12(11)17)8-1-3-10(4-2-8)22-15(18,19)20/h1-5,7H,6H2 |
| InChIKey | TXPJPBKYHGNYLI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |