C17H6ClF11N2 — CID 86699574
5-[2,4-bis(trifluoromethyl)phenyl]-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 86699574) has the molecular formula C17H6ClF11N2 and a molecular weight of 482.68 g/mol. Its IUPAC name is 5-[2,4-bis(trifluoromethyl)phenyl]-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 5-[2,4-bis(trifluoromethyl)phenyl]-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 86699574 |
| Molecular Formula | C17H6ClF11N2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 5-[2,4-bis(trifluoromethyl)phenyl]-6-chloro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)c1ccc(-c2cc3nc(C(F)(F)C(F)(F)F)[nH]c3cc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H6ClF11N2/c18-10-5-12-11(30-13(31-12)14(19,20)17(27,28)29)4-8(10)7-2-1-6(15(21,22)23)3-9(7)16(24,25)26/h1-5H,(H,30,31) |
| InChIKey | ZJZMAZWBWCFHID-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|