C18H7Cl2F10N — CID 118589031
6-chloro-5-[2-chloro-4-(trifluoromethyl)phenyl]-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole (PubChem CID 118589031) has the molecular formula C18H7Cl2F10N and a molecular weight of 498.15 g/mol. Its IUPAC name is 6-chloro-5-[2-chloro-4-(trifluoromethyl)phenyl]-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole.
| Compound Name | 6-chloro-5-[2-chloro-4-(trifluoromethyl)phenyl]-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole |
|---|---|
| PubChem CID | 118589031 |
| Molecular Formula | C18H7Cl2F10N |
| Molecular Weight | 498.15 g/mol |
| Exact Mass | 496.98 |
| IUPAC Name | 6-chloro-5-[2-chloro-4-(trifluoromethyl)phenyl]-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole |
| SMILES | FC(F)(F)c1ccc(-c2cc3cc(C(F)(F)C(F)(F)C(F)(F)F)[nH]c3cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H7Cl2F10N/c19-11-5-8(16(23,24)25)1-2-9(11)10-3-7-4-14(31-13(7)6-12(10)20)15(21,22)17(26,27)18(28,29)30/h1-6,31H |
| InChIKey | WXEVPSBICFJTIQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.15 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|