C11H11F3N2O — CID 59682318
1-(5,6-dimethyl-1H-benzimidazol-2-yl)-2,2,2-trifluoroethanol (PubChem CID 59682318) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1H-benzimidazol-2-yl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(5,6-dimethyl-1H-benzimidazol-2-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 59682318 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(5,6-dimethyl-1H-benzimidazol-2-yl)-2,2,2-trifluoroethanol |
| SMILES | Cc1cc2nc(C(O)C(F)(F)F)[nH]c2cc1C |
| InChI | InChI=1S/C11H11F3N2O/c1-5-3-7-8(4-6(5)2)16-10(15-7)9(17)11(12,13)14/h3-4,9,17H,1-2H3,(H,15,16) |
| InChIKey | FBZJRPMNDDWYKB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |