C17H22N2O2 — CID 115926140
methyl 2-cyclopentyl-2-(5,6-dimethyl-1H-benzimidazol-2-yl)acetate (PubChem CID 115926140) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is methyl 2-cyclopentyl-2-(5,6-dimethyl-1H-benzimidazol-2-yl)acetate.
| Compound Name | methyl 2-cyclopentyl-2-(5,6-dimethyl-1H-benzimidazol-2-yl)acetate |
|---|---|
| PubChem CID | 115926140 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | methyl 2-cyclopentyl-2-(5,6-dimethyl-1H-benzimidazol-2-yl)acetate |
| SMILES | COC(=O)C(c1nc2cc(C)c(C)cc2[nH]1)C1CCCC1 |
| InChI | InChI=1S/C17H22N2O2/c1-10-8-13-14(9-11(10)2)19-16(18-13)15(17(20)21-3)12-6-4-5-7-12/h8-9,12,15H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | JFPVCJKGQKCKCZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |