C15H17FN2O2 — CID 115926134
methyl 2-cyclopentyl-2-(4-fluoro-1H-benzimidazol-2-yl)acetate (PubChem CID 115926134) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is methyl 2-cyclopentyl-2-(4-fluoro-1H-benzimidazol-2-yl)acetate.
| Compound Name | methyl 2-cyclopentyl-2-(4-fluoro-1H-benzimidazol-2-yl)acetate |
|---|---|
| PubChem CID | 115926134 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | methyl 2-cyclopentyl-2-(4-fluoro-1H-benzimidazol-2-yl)acetate |
| SMILES | COC(=O)C(c1nc2c(F)cccc2[nH]1)C1CCCC1 |
| InChI | InChI=1S/C15H17FN2O2/c1-20-15(19)12(9-5-2-3-6-9)14-17-11-8-4-7-10(16)13(11)18-14/h4,7-9,12H,2-3,5-6H2,1H3,(H,17,18) |
| InChIKey | UEXXVHTXNDWHBR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |