C13H23F2NO3 — CID 103209053
3-(2,2-difluoroethoxy)-N-[1-(hydroxymethyl)-3-methylcyclohexyl]propanamide (PubChem CID 103209053) has the molecular formula C13H23F2NO3 and a molecular weight of 279.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[1-(hydroxymethyl)-3-methylcyclohexyl]propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[1-(hydroxymethyl)-3-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 103209053 |
| Molecular Formula | C13H23F2NO3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[1-(hydroxymethyl)-3-methylcyclohexyl]propanamide |
| SMILES | CC1CCCC(CO)(NC(=O)CCOCC(F)F)C1 |
| InChI | InChI=1S/C13H23F2NO3/c1-10-3-2-5-13(7-10,9-17)16-12(18)4-6-19-8-11(14)15/h10-11,17H,2-9H2,1H3,(H,16,18) |
| InChIKey | MCUXOYRRDLCLQG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|