C16H21ClINO2 — CID 103209091
3-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-4-iodobenzamide (PubChem CID 103209091) has the molecular formula C16H21ClINO2 and a molecular weight of 421.71 g/mol. Its IUPAC name is 3-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-4-iodobenzamide.
| Compound Name | 3-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 103209091 |
| Molecular Formula | C16H21ClINO2 |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 3-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-4-iodobenzamide |
| SMILES | CCC1CCC(O)(CNC(=O)c2ccc(I)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21ClINO2/c1-2-11-5-7-16(21,8-6-11)10-19-15(20)12-3-4-14(18)13(17)9-12/h3-4,9,11,21H,2,5-8,10H2,1H3,(H,19,20) |
| InChIKey | DBHOZBXOOADTDP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|