C13H24F2N2O2 — CID 103209647
3-(2,2-difluoroethoxy)-N-ethyl-N-(piperidin-4-ylmethyl)propanamide (PubChem CID 103209647) has the molecular formula C13H24F2N2O2 and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-ethyl-N-(piperidin-4-ylmethyl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-ethyl-N-(piperidin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 103209647 |
| Molecular Formula | C13H24F2N2O2 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-ethyl-N-(piperidin-4-ylmethyl)propanamide |
| SMILES | CCN(CC1CCNCC1)C(=O)CCOCC(F)F |
| InChI | InChI=1S/C13H24F2N2O2/c1-2-17(9-11-3-6-16-7-4-11)13(18)5-8-19-10-12(14)15/h11-12,16H,2-10H2,1H3 |
| InChIKey | YTKMYLNFTOIQSX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|