C16H33N3O — CID 79717040
N,N-diethyl-4-[ethyl(piperidin-4-ylmethyl)amino]butanamide (PubChem CID 79717040) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is N,N-diethyl-4-[ethyl(piperidin-4-ylmethyl)amino]butanamide.
| Compound Name | N,N-diethyl-4-[ethyl(piperidin-4-ylmethyl)amino]butanamide |
|---|---|
| PubChem CID | 79717040 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | N,N-diethyl-4-[ethyl(piperidin-4-ylmethyl)amino]butanamide |
| SMILES | CCN(CCCC(=O)N(CC)CC)CC1CCNCC1 |
| InChI | InChI=1S/C16H33N3O/c1-4-18(14-15-9-11-17-12-10-15)13-7-8-16(20)19(5-2)6-3/h15,17H,4-14H2,1-3H3 |
| InChIKey | ABBUTEURKKIKSI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |