C13H27N3O3S — CID 79717457
3-[2-[ethyl(piperidin-4-ylmethyl)amino]ethylsulfonyl]propanamide (PubChem CID 79717457) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-[2-[ethyl(piperidin-4-ylmethyl)amino]ethylsulfonyl]propanamide.
| Compound Name | 3-[2-[ethyl(piperidin-4-ylmethyl)amino]ethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 79717457 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 3-[2-[ethyl(piperidin-4-ylmethyl)amino]ethylsulfonyl]propanamide |
| SMILES | CCN(CCS(=O)(=O)CCC(N)=O)CC1CCNCC1 |
| InChI | InChI=1S/C13H27N3O3S/c1-2-16(11-12-3-6-15-7-4-12)8-10-20(18,19)9-5-13(14)17/h12,15H,2-11H2,1H3,(H2,14,17) |
| InChIKey | UFPFKBGPGNKOSA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |