C17H33N3O2 — CID 119823717
N,N-diethyl-N'-piperidin-4-yl-N'-propylpentanediamide (PubChem CID 119823717) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is N,N-diethyl-N'-piperidin-4-yl-N'-propylpentanediamide.
| Compound Name | N,N-diethyl-N'-piperidin-4-yl-N'-propylpentanediamide |
|---|---|
| PubChem CID | 119823717 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | N,N-diethyl-N'-piperidin-4-yl-N'-propylpentanediamide |
| SMILES | CCCN(C(=O)CCCC(=O)N(CC)CC)C1CCNCC1 |
| InChI | InChI=1S/C17H33N3O2/c1-4-14-20(15-10-12-18-13-11-15)17(22)9-7-8-16(21)19(5-2)6-3/h15,18H,4-14H2,1-3H3 |
| InChIKey | VYBLJGIAUABZIY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |