C16H15Cl2IO2 — CID 103210753
1-[chloro-(3-chloro-4-iodophenyl)methyl]-4,5-dimethoxy-2-methylbenzene (PubChem CID 103210753) has the molecular formula C16H15Cl2IO2 and a molecular weight of 437.10 g/mol. Its IUPAC name is 1-[chloro-(3-chloro-4-iodophenyl)methyl]-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-[chloro-(3-chloro-4-iodophenyl)methyl]-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 103210753 |
| Molecular Formula | C16H15Cl2IO2 |
| Molecular Weight | 437.10 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | 1-[chloro-(3-chloro-4-iodophenyl)methyl]-4,5-dimethoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(C(Cl)c2ccc(I)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C16H15Cl2IO2/c1-9-6-14(20-2)15(21-3)8-11(9)16(18)10-4-5-13(19)12(17)7-10/h4-8,16H,1-3H3 |
| InChIKey | TWIXEAGLVHEVRI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.10 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|