C16H15ClF2O2 — CID 61085061
1-[chloro-(3,4-difluorophenyl)methyl]-4,5-dimethoxy-2-methylbenzene (PubChem CID 61085061) has the molecular formula C16H15ClF2O2 and a molecular weight of 312.74 g/mol. Its IUPAC name is 1-[chloro-(3,4-difluorophenyl)methyl]-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-[chloro-(3,4-difluorophenyl)methyl]-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 61085061 |
| Molecular Formula | C16H15ClF2O2 |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 1-[chloro-(3,4-difluorophenyl)methyl]-4,5-dimethoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(C(Cl)c2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C16H15ClF2O2/c1-9-6-14(20-2)15(21-3)8-11(9)16(17)10-4-5-12(18)13(19)7-10/h4-8,16H,1-3H3 |
| InChIKey | ZZVJQZLTGIWWEQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|