C9H15BrF3NO2 — CID 103212563
N-(5-bromopentan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103212563) has the molecular formula C9H15BrF3NO2 and a molecular weight of 306.12 g/mol. Its IUPAC name is N-(5-bromopentan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(5-bromopentan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103212563 |
| Molecular Formula | C9H15BrF3NO2 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-(5-bromopentan-2-yl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CC(CCCBr)NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C9H15BrF3NO2/c1-7(3-2-4-10)14-8(15)5-16-6-9(11,12)13/h7H,2-6H2,1H3,(H,14,15) |
| InChIKey | NCYQZCHIXVSUCW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|