C14H17BrF3NO2 — CID 103212850
N-(1-bromo-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103212850) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is N-(1-bromo-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(1-bromo-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103212850 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-(1-bromo-2-phenylpropan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(CBr)(NC(=O)CCOCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H17BrF3NO2/c1-13(9-15,11-5-3-2-4-6-11)19-12(20)7-8-21-10-14(16,17)18/h2-6H,7-10H2,1H3,(H,19,20) |
| InChIKey | LPVYRLFQQWXLAZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|