C13H16F3N3O — CID 103213105
[1-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-5-yl]methanamine (PubChem CID 103213105) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is [1-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-5-yl]methanamine.
| Compound Name | [1-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103213105 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [1-methyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-5-yl]methanamine |
| SMILES | Cn1c(CCOCC(F)(F)F)nc2cc(CN)ccc21 |
| InChI | InChI=1S/C13H16F3N3O/c1-19-11-3-2-9(7-17)6-10(11)18-12(19)4-5-20-8-13(14,15)16/h2-3,6H,4-5,7-8,17H2,1H3 |
| InChIKey | RAQOOONEUIOWKD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|