C14H24ClN3OSi — CID 175873605
[1-methyl-2-(2-trimethylsilylethoxy)benzimidazol-5-yl]methanamine;hydrochloride (PubChem CID 175873605) has the molecular formula C14H24ClN3OSi and a molecular weight of 313.91 g/mol. Its IUPAC name is [1-methyl-2-(2-trimethylsilylethoxy)benzimidazol-5-yl]methanamine;hydrochloride.
| Compound Name | [1-methyl-2-(2-trimethylsilylethoxy)benzimidazol-5-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 175873605 |
| Molecular Formula | C14H24ClN3OSi |
| Molecular Weight | 313.91 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [1-methyl-2-(2-trimethylsilylethoxy)benzimidazol-5-yl]methanamine;hydrochloride |
| SMILES | Cl.Cn1c(OCC[Si](C)(C)C)nc2cc(CN)ccc21 |
| InChI | InChI=1S/C14H23N3OSi.ClH/c1-17-13-6-5-11(10-15)9-12(13)16-14(17)18-7-8-19(2,3)4;/h5-6,9H,7-8,10,15H2,1-4H3;1H |
| InChIKey | LENGCRGWQVIRTM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.91 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|