C14H17F2N3OS — CID 103213366
1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-methyl-1-phenylmethanamine (PubChem CID 103213366) has the molecular formula C14H17F2N3OS and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-methyl-1-phenylmethanamine.
| Compound Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 103213366 |
| Molecular Formula | C14H17F2N3OS |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]-N-methyl-1-phenylmethanamine |
| SMILES | CNC(c1ccccc1)c1nnc(CCOCC(F)F)s1 |
| InChI | InChI=1S/C14H17F2N3OS/c1-17-13(10-5-3-2-4-6-10)14-19-18-12(21-14)7-8-20-9-11(15)16/h2-6,11,13,17H,7-9H2,1H3 |
| InChIKey | LBPCJPREXPOEJW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|