C11H16F2N4O3 — CID 103213526
1-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]cyclobutane-1-carboxylic acid (PubChem CID 103213526) has the molecular formula C11H16F2N4O3 and a molecular weight of 290.27 g/mol. Its IUPAC name is 1-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103213526 |
| Molecular Formula | C11H16F2N4O3 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[[5-[2-(2,2-difluoroethoxy)ethyl]tetrazol-1-yl]methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cn2nnnc2CCOCC(F)F)CCC1 |
| InChI | InChI=1S/C11H16F2N4O3/c12-8(13)6-20-5-2-9-14-15-16-17(9)7-11(10(18)19)3-1-4-11/h8H,1-7H2,(H,18,19) |
| InChIKey | XYZRHRHGALBULF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|