C9H14ClF2N3O — CID 103213685
3-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole (PubChem CID 103213685) has the molecular formula C9H14ClF2N3O and a molecular weight of 253.68 g/mol. Its IUPAC name is 3-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 103213685 |
| Molecular Formula | C9H14ClF2N3O |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole |
| SMILES | CCn1c(CCl)nnc1CCOCC(F)F |
| InChI | InChI=1S/C9H14ClF2N3O/c1-2-15-8(13-14-9(15)5-10)3-4-16-6-7(11)12/h7H,2-6H2,1H3 |
| InChIKey | XIFMYQXPSFFEBC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|