C9H15F2N3O — CID 103213655
3-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole (PubChem CID 103213655) has the molecular formula C9H15F2N3O and a molecular weight of 219.23 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 103213655 |
| Molecular Formula | C9H15F2N3O |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1cnnc1CCOCC(F)F |
| InChI | InChI=1S/C9H15F2N3O/c1-7(2)14-6-12-13-9(14)3-4-15-5-8(10)11/h6-8H,3-5H2,1-2H3 |
| InChIKey | CHLDWMCWWXHNGH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|