C11H17ClF3N3O — CID 103213695
3-(chloromethyl)-4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole (PubChem CID 103213695) has the molecular formula C11H17ClF3N3O and a molecular weight of 299.72 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 103213695 |
| Molecular Formula | C11H17ClF3N3O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-(chloromethyl)-4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole |
| SMILES | CC(C)Cn1c(CCl)nnc1CCOCC(F)(F)F |
| InChI | InChI=1S/C11H17ClF3N3O/c1-8(2)6-18-9(16-17-10(18)5-12)3-4-19-7-11(13,14)15/h8H,3-7H2,1-2H3 |
| InChIKey | BTBUJMZSMRILFL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|