C21H23F2N5O4 — CID 10321380
5-amino-1-cyclopropyl-6,8-difluoro-7-[(8E)-8-methoxyimino-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 10321380) has the molecular formula C21H23F2N5O4 and a molecular weight of 447.44 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6,8-difluoro-7-[(8E)-8-methoxyimino-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-[(8E)-8-methoxyimino-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10321380 |
| Molecular Formula | C21H23F2N5O4 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-[(8E)-8-methoxyimino-2-methyl-2,6-diazaspiro[3.4]octan-6-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CO/N=C1/CN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)CC12CN(C)C2 |
| InChI | InChI=1S/C21H23F2N5O4/c1-26-7-21(8-26)9-27(6-12(21)25-32-2)18-14(22)16(24)13-17(15(18)23)28(10-3-4-10)5-11(19(13)29)20(30)31/h5,10H,3-4,6-9,24H2,1-2H3,(H,30,31)/b25-12- |
| InChIKey | HODQTXZTGLCZBD-ROTLSHHCSA-N |
| XLogP | 1.65 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|