About 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one
1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one (PubChem CID 103214034) has the molecular formula C10H15F3O3
and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one |
| PubChem CID | 103214034 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one |
| SMILES | O=C(COCC(F)(F)F)CC1CCOCC1 |
| InChI | InChI=1S/C10H15F3O3/c11-10(12,13)7-16-6-9(14)5-8-1-3-15-4-2-8/h8H,1-7H2 |
| InChIKey | PFWGFZDGJKEYEE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one?
The IUPAC name of 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one (CID 103214034) is 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one.
What is the SMILES notation for 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one?
The canonical SMILES for 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one is O=C(COCC(F)(F)F)CC1CCOCC1.
What is the InChIKey of 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one?
The InChIKey is PFWGFZDGJKEYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O3/c11-10(12,13)7-16-6-9(14)5-8-1-3-15-4-2-8/h8H,1-7H2.
What are the key properties of 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one?
1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one has a molecular weight of 240.22 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one is sourced from PubChem (CID 103214034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).