C10H15F3O3 — CID 103214034
1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one (PubChem CID 103214034) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one.
| Compound Name | 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one |
|---|---|
| PubChem CID | 103214034 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(oxan-4-yl)-3-(2,2,2-trifluoroethoxy)propan-2-one |
| SMILES | O=C(COCC(F)(F)F)CC1CCOCC1 |
| InChI | InChI=1S/C10H15F3O3/c11-10(12,13)7-16-6-9(14)5-8-1-3-15-4-2-8/h8H,1-7H2 |
| InChIKey | PFWGFZDGJKEYEE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |