C10H17F3O2 — CID 103214045
5,5-dimethyl-1-(2,2,2-trifluoroethoxy)hexan-2-one (PubChem CID 103214045) has the molecular formula C10H17F3O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2,2,2-trifluoroethoxy)hexan-2-one.
| Compound Name | 5,5-dimethyl-1-(2,2,2-trifluoroethoxy)hexan-2-one |
|---|---|
| PubChem CID | 103214045 |
| Molecular Formula | C10H17F3O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 5,5-dimethyl-1-(2,2,2-trifluoroethoxy)hexan-2-one |
| SMILES | CC(C)(C)CCC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C10H17F3O2/c1-9(2,3)5-4-8(14)6-15-7-10(11,12)13/h4-7H2,1-3H3 |
| InChIKey | HFSGWFXOIXTKTO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |