C13H15ClIN3 — CID 103215295
(3-chloro-4-iodophenyl)-(2-propylpyrazol-3-yl)methanamine (PubChem CID 103215295) has the molecular formula C13H15ClIN3 and a molecular weight of 375.64 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(2-propylpyrazol-3-yl)methanamine.
| Compound Name | (3-chloro-4-iodophenyl)-(2-propylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 103215295 |
| Molecular Formula | C13H15ClIN3 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(2-propylpyrazol-3-yl)methanamine |
| SMILES | CCCn1nccc1C(N)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClIN3/c1-2-7-18-12(5-6-17-18)13(16)9-3-4-11(15)10(14)8-9/h3-6,8,13H,2,7,16H2,1H3 |
| InChIKey | XDNBHXWXMKLVHM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|