C11H13Cl2N3S — CID 107968266
(2,5-dichlorothiophen-3-yl)-(2-propylpyrazol-3-yl)methanamine (PubChem CID 107968266) has the molecular formula C11H13Cl2N3S and a molecular weight of 290.22 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(2-propylpyrazol-3-yl)methanamine.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(2-propylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 107968266 |
| Molecular Formula | C11H13Cl2N3S |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(2-propylpyrazol-3-yl)methanamine |
| SMILES | CCCn1nccc1C(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H13Cl2N3S/c1-2-5-16-8(3-4-15-16)10(14)7-6-9(12)17-11(7)13/h3-4,6,10H,2,5,14H2,1H3 |
| InChIKey | SNVALBRWSDEDCF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |