C16H21ClINO — CID 103215917
(3-chloro-4-iodophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanamine (PubChem CID 103215917) has the molecular formula C16H21ClINO and a molecular weight of 405.71 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanamine.
| Compound Name | (3-chloro-4-iodophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanamine |
|---|---|
| PubChem CID | 103215917 |
| Molecular Formula | C16H21ClINO |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanamine |
| SMILES | NC(c1ccc(I)c(Cl)c1)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C16H21ClINO/c17-13-9-11(3-4-14(13)18)15(19)12-5-8-20-16(10-12)6-1-2-7-16/h3-4,9,12,15H,1-2,5-8,10,19H2 |
| InChIKey | HHELRMKGGFNANV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|