C17H17ClINO — CID 103216192
N-[(3-chloro-4-iodophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]ethanamine (PubChem CID 103216192) has the molecular formula C17H17ClINO and a molecular weight of 413.69 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]ethanamine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103216192 |
| Molecular Formula | C17H17ClINO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)c(Cl)c1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H17ClINO/c1-2-20-17(13-3-5-15(19)14(18)10-13)12-4-6-16-11(9-12)7-8-21-16/h3-6,9-10,17,20H,2,7-8H2,1H3 |
| InChIKey | PAPPZOJWIQHCAU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|