C17H19NO — CID 43489842
N-[2,3-dihydro-1-benzofuran-5-yl(phenyl)methyl]ethanamine (PubChem CID 43489842) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[2,3-dihydro-1-benzofuran-5-yl(phenyl)methyl]ethanamine.
| Compound Name | N-[2,3-dihydro-1-benzofuran-5-yl(phenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43489842 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[2,3-dihydro-1-benzofuran-5-yl(phenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccccc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H19NO/c1-2-18-17(13-6-4-3-5-7-13)15-8-9-16-14(12-15)10-11-19-16/h3-9,12,17-18H,2,10-11H2,1H3 |
| InChIKey | IJNNGOLQQMKLHM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |