C12H25F3N2O — CID 103217300
[4-ethyl-1-(2,2,2-trifluoroethoxy)octan-2-yl]hydrazine (PubChem CID 103217300) has the molecular formula C12H25F3N2O and a molecular weight of 270.34 g/mol. Its IUPAC name is [4-ethyl-1-(2,2,2-trifluoroethoxy)octan-2-yl]hydrazine.
| Compound Name | [4-ethyl-1-(2,2,2-trifluoroethoxy)octan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217300 |
| Molecular Formula | C12H25F3N2O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | [4-ethyl-1-(2,2,2-trifluoroethoxy)octan-2-yl]hydrazine |
| SMILES | CCCCC(CC)CC(COCC(F)(F)F)NN |
| InChI | InChI=1S/C12H25F3N2O/c1-3-5-6-10(4-2)7-11(17-16)8-18-9-12(13,14)15/h10-11,17H,3-9,16H2,1-2H3 |
| InChIKey | RROSBLMWHORDER-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|