C11H22F3N3O3S — CID 103217639
[1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine (PubChem CID 103217639) has the molecular formula C11H22F3N3O3S and a molecular weight of 333.38 g/mol. Its IUPAC name is [1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217639 |
| Molecular Formula | C11H22F3N3O3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
| SMILES | CS(=O)(=O)N1CCCC(CC(COCC(F)(F)F)NN)C1 |
| InChI | InChI=1S/C11H22F3N3O3S/c1-21(18,19)17-4-2-3-9(6-17)5-10(16-15)7-20-8-11(12,13)14/h9-10,16H,2-8,15H2,1H3 |
| InChIKey | UIXZXYROIYKQRJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|