C11H24N2O2S2 — CID 79612431
N-methyl-1-methylsulfanyl-3-(1-methylsulfonylpiperidin-3-yl)propan-2-amine (PubChem CID 79612431) has the molecular formula C11H24N2O2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is N-methyl-1-methylsulfanyl-3-(1-methylsulfonylpiperidin-3-yl)propan-2-amine.
| Compound Name | N-methyl-1-methylsulfanyl-3-(1-methylsulfonylpiperidin-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 79612431 |
| Molecular Formula | C11H24N2O2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-methyl-1-methylsulfanyl-3-(1-methylsulfonylpiperidin-3-yl)propan-2-amine |
| SMILES | CNC(CSC)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H24N2O2S2/c1-12-11(9-16-2)7-10-5-4-6-13(8-10)17(3,14)15/h10-12H,4-9H2,1-3H3 |
| InChIKey | QLEYBDWRTPMXOA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |