C15H32N2O3S — CID 116760948
3-ethyl-3-methoxy-N-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-amine (PubChem CID 116760948) has the molecular formula C15H32N2O3S and a molecular weight of 320.50 g/mol. Its IUPAC name is 3-ethyl-3-methoxy-N-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-amine.
| Compound Name | 3-ethyl-3-methoxy-N-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-amine |
|---|---|
| PubChem CID | 116760948 |
| Molecular Formula | C15H32N2O3S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-ethyl-3-methoxy-N-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-amine |
| SMILES | CCC(CC)(OC)C(CC1CCCN(S(C)(=O)=O)C1)NC |
| InChI | InChI=1S/C15H32N2O3S/c1-6-15(7-2,20-4)14(16-3)11-13-9-8-10-17(12-13)21(5,18)19/h13-14,16H,6-12H2,1-5H3 |
| InChIKey | JEPXYTKLMQUJRV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |