C13H6ClIN4 — CID 103217881
3-(3-chloro-4-iodophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile (PubChem CID 103217881) has the molecular formula C13H6ClIN4 and a molecular weight of 380.58 g/mol. Its IUPAC name is 3-(3-chloro-4-iodophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile.
| Compound Name | 3-(3-chloro-4-iodophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 103217881 |
| Molecular Formula | C13H6ClIN4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 3-(3-chloro-4-iodophenyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile |
| SMILES | N#Cc1ccn2c(-c3ccc(I)c(Cl)c3)nnc2c1 |
| InChI | InChI=1S/C13H6ClIN4/c14-10-6-9(1-2-11(10)15)13-18-17-12-5-8(7-16)3-4-19(12)13/h1-6H |
| InChIKey | PDOCBQFQYZGAQT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|