C8H13N3O3 — CID 103218588
2-(2,3-dihydroxypropyl)-5-(methylamino)pyridazin-3-one (PubChem CID 103218588) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-5-(methylamino)pyridazin-3-one.
| Compound Name | 2-(2,3-dihydroxypropyl)-5-(methylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103218588 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-5-(methylamino)pyridazin-3-one |
| SMILES | CNc1cnn(CC(O)CO)c(=O)c1 |
| InChI | InChI=1S/C8H13N3O3/c1-9-6-2-8(14)11(10-3-6)4-7(13)5-12/h2-3,7,9,12-13H,4-5H2,1H3 |
| InChIKey | HKYFEVJBRJOCCO-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |