C7H11N3O3 — CID 103218304
5-amino-2-(2,3-dihydroxypropyl)pyridazin-3-one (PubChem CID 103218304) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 5-amino-2-(2,3-dihydroxypropyl)pyridazin-3-one.
| Compound Name | 5-amino-2-(2,3-dihydroxypropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103218304 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-amino-2-(2,3-dihydroxypropyl)pyridazin-3-one |
| SMILES | Nc1cnn(CC(O)CO)c(=O)c1 |
| InChI | InChI=1S/C7H11N3O3/c8-5-1-7(13)10(9-2-5)3-6(12)4-11/h1-2,6,11-12H,3-4,8H2 |
| InChIKey | HVLZWPKIAUKYBK-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |