C9H15N3O3 — CID 103219027
2-(2,3-dihydroxypropyl)-5-(ethylamino)pyridazin-3-one (PubChem CID 103219027) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-5-(ethylamino)pyridazin-3-one.
| Compound Name | 2-(2,3-dihydroxypropyl)-5-(ethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103219027 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-5-(ethylamino)pyridazin-3-one |
| SMILES | CCNc1cnn(CC(O)CO)c(=O)c1 |
| InChI | InChI=1S/C9H15N3O3/c1-2-10-7-3-9(15)12(11-4-7)5-8(14)6-13/h3-4,8,10,13-14H,2,5-6H2,1H3 |
| InChIKey | FMEHSKFRYAYSPG-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |